C35H33IN2S2 — CID 45026349
1-ethyl-2-[(E)-2-[(E)-[3-ethyl-6-[(E)-2-phenylethenyl]-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzothiazol-1-ium iodide (PubChem CID 45026349) has the molecular formula C35H33IN2S2 and a molecular weight of 672.70 g/mol. Its IUPAC name is 1-ethyl-2-[(E)-2-[(E)-[3-ethyl-6-[(E)-2-phenylethenyl]-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzothiazol-1-ium iodide.
| Compound Name | 1-ethyl-2-[(E)-2-[(E)-[3-ethyl-6-[(E)-2-phenylethenyl]-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzothiazol-1-ium iodide |
|---|---|
| PubChem CID | 45026349 |
| Molecular Formula | C35H33IN2S2 |
| Molecular Weight | 672.70 g/mol |
| Exact Mass | 672.11 |
| IUPAC Name | 1-ethyl-2-[(E)-2-[(E)-[3-ethyl-6-[(E)-2-phenylethenyl]-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzothiazol-1-ium iodide |
| SMILES | CCC(=C\c1sc2ccc3ccccc3c2[n+]1CC)/C=C1/Sc2cc(/C=C/c3ccccc3)ccc2N1CC.[I-] |
| InChI | InChI=1S/C35H33N2S2.HI/c1-4-25(24-34-37(6-3)35-29-15-11-10-14-28(29)19-21-31(35)38-34)23-33-36(5-2)30-20-18-27(22-32(30)39-33)17-16-26-12-8-7-9-13-26;/h7-24H,4-6H2,1-3H3;1H/q+1;/p-1/b17-16+; |
| InChIKey | ZQTJIRVQEAXYJA-CMBBICFISA-M |
| XLogP | 6.80 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.70 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|