C23H20Cl2N2O4S2 — CID 160673546
2-[(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-1-ethylbenzo[e][1,3]benzothiazol-1-ium perchlorate (PubChem CID 160673546) has the molecular formula C23H20Cl2N2O4S2 and a molecular weight of 523.46 g/mol. Its IUPAC name is 2-[(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-1-ethylbenzo[e][1,3]benzothiazol-1-ium perchlorate.
| Compound Name | 2-[(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-1-ethylbenzo[e][1,3]benzothiazol-1-ium perchlorate |
|---|---|
| PubChem CID | 160673546 |
| Molecular Formula | C23H20Cl2N2O4S2 |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 522.02 |
| IUPAC Name | 2-[(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-1-ethylbenzo[e][1,3]benzothiazol-1-ium perchlorate |
| SMILES | CCN1C(=Cc2sc3ccc4ccccc4c3[n+]2CC)Sc2ccc(Cl)cc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H20ClN2S2.ClHO4/c1-3-25-18-13-16(24)10-12-19(18)27-21(25)14-22-26(4-2)23-17-8-6-5-7-15(17)9-11-20(23)28-22;2-1(3,4)5/h5-14H,3-4H2,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | RNFWZUNBRKVRMC-UHFFFAOYSA-M |
| XLogP | 2.19 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|