C20H18Cl2N3OS2+ — CID 59958014
N-[[5-chloro-2-[(Z)-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]methyl]acetamide (PubChem CID 59958014) has the molecular formula C20H18Cl2N3OS2+ and a molecular weight of 451.42 g/mol. Its IUPAC name is N-[[5-chloro-2-[(Z)-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]methyl]acetamide.
| Compound Name | N-[[5-chloro-2-[(Z)-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 59958014 |
| Molecular Formula | C20H18Cl2N3OS2+ |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | N-[[5-chloro-2-[(Z)-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]methyl]acetamide |
| SMILES | CCN1/C(=C/c2sc3ccc(Cl)cc3[n+]2CNC(C)=O)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H17Cl2N3OS2/c1-3-24-15-8-13(21)4-6-17(15)27-19(24)10-20-25(11-23-12(2)26)16-9-14(22)5-7-18(16)28-20/h4-10H,3,11H2,1-2H3/p+1 |
| InChIKey | YDZAMQAZUVSCQY-UHFFFAOYSA-O |
| XLogP | 5.52 |
| TPSA | 36.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|