C21H21Cl2N2O2S2+ — CID 59121519
5-chloro-2-[[5-chloro-3-(2-methoxyethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-3-(2-methoxyethyl)-1,3-benzothiazole (PubChem CID 59121519) has the molecular formula C21H21Cl2N2O2S2+ and a molecular weight of 468.45 g/mol. Its IUPAC name is 5-chloro-2-[[5-chloro-3-(2-methoxyethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-3-(2-methoxyethyl)-1,3-benzothiazole.
| Compound Name | 5-chloro-2-[[5-chloro-3-(2-methoxyethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-3-(2-methoxyethyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 59121519 |
| Molecular Formula | C21H21Cl2N2O2S2+ |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | 5-chloro-2-[[5-chloro-3-(2-methoxyethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-3-(2-methoxyethyl)-1,3-benzothiazole |
| SMILES | COCCN1C(=Cc2sc3ccc(Cl)cc3[n+]2CCOC)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H21Cl2N2O2S2/c1-26-9-7-24-16-11-14(22)3-5-18(16)28-20(24)13-21-25(8-10-27-2)17-12-15(23)4-6-19(17)29-21/h3-6,11-13H,7-10H2,1-2H3/q+1 |
| InChIKey | HHFROJSOXIZSCT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 25.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|