C23H25Cl2N2O6S4+ — CID 59035374
4-[5-chloro-2-[[5-chloro-3-[2-(ethylidene-hydroxy-oxo-λ6-sulfanyl)oxyethyl]-1,3-benzothiazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]butane-2-sulfonic acid (PubChem CID 59035374) has the molecular formula C23H25Cl2N2O6S4+ and a molecular weight of 624.64 g/mol. Its IUPAC name is 4-[5-chloro-2-[[5-chloro-3-[2-(ethylidene-hydroxy-oxo-λ6-sulfanyl)oxyethyl]-1,3-benzothiazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]butane-2-sulfonic acid.
| Compound Name | 4-[5-chloro-2-[[5-chloro-3-[2-(ethylidene-hydroxy-oxo-λ6-sulfanyl)oxyethyl]-1,3-benzothiazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]butane-2-sulfonic acid |
|---|---|
| PubChem CID | 59035374 |
| Molecular Formula | C23H25Cl2N2O6S4+ |
| Molecular Weight | 624.64 g/mol |
| Exact Mass | 623.00 |
| IUPAC Name | 4-[5-chloro-2-[[5-chloro-3-[2-(ethylidene-hydroxy-oxo-λ6-sulfanyl)oxyethyl]-1,3-benzothiazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]butane-2-sulfonic acid |
| SMILES | CC=S(=O)(O)OCCN1C(=Cc2sc3ccc(Cl)cc3[n+]2CCC(C)S(=O)(=O)O)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C23H24Cl2N2O6S4/c1-3-36(28,29)33-11-10-27-19-13-17(25)5-7-21(19)35-23(27)14-22-26(9-8-15(2)37(30,31)32)18-12-16(24)4-6-20(18)34-22/h3-7,12-15H,8-11H2,1-2H3,(H-,28,29,30,31,32)/p+1 |
| InChIKey | IQJRWPZTSFLOQB-UHFFFAOYSA-O |
| XLogP | 5.58 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.64 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|