C21H23ClN2O4S3 — CID 173438767
4-[5-chloro-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]butane-2-sulfonic acid hydroxide (PubChem CID 173438767) has the molecular formula C21H23ClN2O4S3 and a molecular weight of 499.08 g/mol. Its IUPAC name is 4-[5-chloro-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]butane-2-sulfonic acid hydroxide.
| Compound Name | 4-[5-chloro-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]butane-2-sulfonic acid hydroxide |
|---|---|
| PubChem CID | 173438767 |
| Molecular Formula | C21H23ClN2O4S3 |
| Molecular Weight | 499.08 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | 4-[5-chloro-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]butane-2-sulfonic acid hydroxide |
| SMILES | CC[n+]1c(C=C2Sc3ccc(Cl)cc3N2CCC(C)S(=O)(=O)O)sc2ccccc21.[OH-] |
| InChI | InChI=1S/C21H21ClN2O3S3.H2O/c1-3-23-16-6-4-5-7-18(16)28-20(23)13-21-24(11-10-14(2)30(25,26)27)17-12-15(22)8-9-19(17)29-21;/h4-9,12-14H,3,10-11H2,1-2H3;1H2 |
| InChIKey | XGWBFKODPRXXFA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.08 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|