C21H23N2O3S3+ — CID 46499292
3-[(2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-methyl-1,3-benzothiazol-3-yl]propane-1-sulfonic acid (PubChem CID 46499292) has the molecular formula C21H23N2O3S3+ and a molecular weight of 447.63 g/mol. Its IUPAC name is 3-[(2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-methyl-1,3-benzothiazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-methyl-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 46499292 |
| Molecular Formula | C21H23N2O3S3+ |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 3-[(2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-methyl-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
| SMILES | CC[n+]1c(/C=C2\Sc3ccc(C)cc3N2CCCS(=O)(=O)O)sc2ccccc21 |
| InChI | InChI=1S/C21H22N2O3S3/c1-3-22-16-7-4-5-8-18(16)27-20(22)14-21-23(11-6-12-29(24,25)26)17-13-15(2)9-10-19(17)28-21/h4-5,7-10,13-14H,3,6,11-12H2,1-2H3/p+1 |
| InChIKey | WGIANPJTBFJQSH-UHFFFAOYSA-O |
| XLogP | 4.71 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|