C20H20N2O3S3 — CID 3144366
3-[2-[(3,5-dimethyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate (PubChem CID 3144366) has the molecular formula C20H20N2O3S3 and a molecular weight of 432.59 g/mol. Its IUPAC name is 3-[2-[(3,5-dimethyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[(3,5-dimethyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 3144366 |
| Molecular Formula | C20H20N2O3S3 |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 3-[2-[(3,5-dimethyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
| SMILES | Cc1ccc2c(c1)N(C)C(=Cc1sc3ccccc3[n+]1CCCS(=O)(=O)[O-])S2 |
| InChI | InChI=1S/C20H20N2O3S3/c1-14-8-9-18-16(12-14)21(2)19(26-18)13-20-22(10-5-11-28(23,24)25)15-6-3-4-7-17(15)27-20/h3-4,6-9,12-13H,5,10-11H2,1-2H3 |
| InChIKey | OMBMQPCQMUOVAC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|