C21H23N2O4S3+ — CID 46500422
3-[2-[(Z)-[3-(2-hydroxyethyl)-1,3-benzothiazol-2-ylidene]methyl]-6-methyl-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid (PubChem CID 46500422) has the molecular formula C21H23N2O4S3+ and a molecular weight of 463.63 g/mol. Its IUPAC name is 3-[2-[(Z)-[3-(2-hydroxyethyl)-1,3-benzothiazol-2-ylidene]methyl]-6-methyl-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(Z)-[3-(2-hydroxyethyl)-1,3-benzothiazol-2-ylidene]methyl]-6-methyl-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 46500422 |
| Molecular Formula | C21H23N2O4S3+ |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 3-[2-[(Z)-[3-(2-hydroxyethyl)-1,3-benzothiazol-2-ylidene]methyl]-6-methyl-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid |
| SMILES | Cc1ccc2c(c1)sc(/C=C1\Sc3ccccc3N1CCO)[n+]2CCCS(=O)(=O)O |
| InChI | InChI=1S/C21H22N2O4S3/c1-15-7-8-17-19(13-15)29-20(22(17)9-4-12-30(25,26)27)14-21-23(10-11-24)16-5-2-3-6-18(16)28-21/h2-3,5-8,13-14,24H,4,9-12H2,1H3/p+1 |
| InChIKey | WSTMLMHZZCGFGC-UHFFFAOYSA-O |
| XLogP | 3.68 |
| TPSA | 81.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|