C21H19N2S3+ — CID 22332363
1-ethyl-2-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]thieno[3,2-e][1,3]benzothiazol-1-ium (PubChem CID 22332363) has the molecular formula C21H19N2S3+ and a molecular weight of 395.60 g/mol. Its IUPAC name is 1-ethyl-2-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]thieno[3,2-e][1,3]benzothiazol-1-ium.
| Compound Name | 1-ethyl-2-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]thieno[3,2-e][1,3]benzothiazol-1-ium |
|---|---|
| PubChem CID | 22332363 |
| Molecular Formula | C21H19N2S3+ |
| Molecular Weight | 395.60 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 1-ethyl-2-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]thieno[3,2-e][1,3]benzothiazol-1-ium |
| SMILES | CCN1/C(=C/c2sc3ccc4sccc4c3[n+]2CC)Sc2ccccc21 |
| InChI | InChI=1S/C21H19N2S3/c1-3-22-15-7-5-6-8-17(15)25-19(22)13-20-23(4-2)21-14-11-12-24-16(14)9-10-18(21)26-20/h5-13H,3-4H2,1-2H3/q+1 |
| InChIKey | WEEPMVCFJSXJCW-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|