C27H26Cl2N3S+ — CID 177466797
2-[(E)-3-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-1-ethylbenzo[e][1,3]benzothiazol-1-ium (PubChem CID 177466797) has the molecular formula C27H26Cl2N3S+ and a molecular weight of 495.50 g/mol. Its IUPAC name is 2-[(E)-3-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-1-ethylbenzo[e][1,3]benzothiazol-1-ium.
| Compound Name | 2-[(E)-3-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-1-ethylbenzo[e][1,3]benzothiazol-1-ium |
|---|---|
| PubChem CID | 177466797 |
| Molecular Formula | C27H26Cl2N3S+ |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 2-[(E)-3-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-1-ethylbenzo[e][1,3]benzothiazol-1-ium |
| SMILES | CCN1C(=C/C=C/c2sc3ccc4ccccc4c3[n+]2CC)N(CC)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C27H26Cl2N3S/c1-4-30-22-16-20(28)21(29)17-23(22)31(5-2)25(30)12-9-13-26-32(6-3)27-19-11-8-7-10-18(19)14-15-24(27)33-26/h7-17H,4-6H2,1-3H3/q+1 |
| InChIKey | RVMNMVNVALUAKG-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|