C33H29N2S2+ — CID 5477256
(2Z)-1-ethyl-2-[(2E,4E,6E)-7-(1-ethylbenzo[e][1,3]benzothiazol-1-ium-2-yl)hepta-2,4,6-trienylidene]benzo[e][1,3]benzothiazole (PubChem CID 5477256) has the molecular formula C33H29N2S2+ and a molecular weight of 517.74 g/mol. Its IUPAC name is (2Z)-1-ethyl-2-[(2E,4E,6E)-7-(1-ethylbenzo[e][1,3]benzothiazol-1-ium-2-yl)hepta-2,4,6-trienylidene]benzo[e][1,3]benzothiazole.
| Compound Name | (2Z)-1-ethyl-2-[(2E,4E,6E)-7-(1-ethylbenzo[e][1,3]benzothiazol-1-ium-2-yl)hepta-2,4,6-trienylidene]benzo[e][1,3]benzothiazole |
|---|---|
| PubChem CID | 5477256 |
| Molecular Formula | C33H29N2S2+ |
| Molecular Weight | 517.74 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | (2Z)-1-ethyl-2-[(2E,4E,6E)-7-(1-ethylbenzo[e][1,3]benzothiazol-1-ium-2-yl)hepta-2,4,6-trienylidene]benzo[e][1,3]benzothiazole |
| SMILES | CCN1/C(=C/C=C/C=C/C=C/c2sc3ccc4ccccc4c3[n+]2CC)Sc2ccc3ccccc3c21 |
| InChI | InChI=1S/C33H29N2S2/c1-3-34-30(36-28-22-20-24-14-10-12-16-26(24)32(28)34)18-8-6-5-7-9-19-31-35(4-2)33-27-17-13-11-15-25(27)21-23-29(33)37-31/h5-23H,3-4H2,1-2H3/q+1 |
| InChIKey | LRHBWLRWTFPMSF-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.74 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|