C17H19N2S+ — CID 4529269
2-(1-ethylbenzo[e][1,3]benzothiazol-1-ium-2-yl)-N,N-dimethylethenamine (PubChem CID 4529269) has the molecular formula C17H19N2S+ and a molecular weight of 283.42 g/mol. Its IUPAC name is 2-(1-ethylbenzo[e][1,3]benzothiazol-1-ium-2-yl)-N,N-dimethylethenamine.
| Compound Name | 2-(1-ethylbenzo[e][1,3]benzothiazol-1-ium-2-yl)-N,N-dimethylethenamine |
|---|---|
| PubChem CID | 4529269 |
| Molecular Formula | C17H19N2S+ |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-(1-ethylbenzo[e][1,3]benzothiazol-1-ium-2-yl)-N,N-dimethylethenamine |
| SMILES | CC[n+]1c(C=CN(C)C)sc2ccc3ccccc3c21 |
| InChI | InChI=1S/C17H19N2S/c1-4-19-16(11-12-18(2)3)20-15-10-9-13-7-5-6-8-14(13)17(15)19/h5-12H,4H2,1-3H3/q+1 |
| InChIKey | SFQFZCQRIGQPCK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|