C15H21N2S+ — CID 54084639
2-(3-butyl-1,3-benzothiazol-3-ium-2-yl)-N,N-dimethylethenamine (PubChem CID 54084639) has the molecular formula C15H21N2S+ and a molecular weight of 261.41 g/mol. Its IUPAC name is 2-(3-butyl-1,3-benzothiazol-3-ium-2-yl)-N,N-dimethylethenamine.
| Compound Name | 2-(3-butyl-1,3-benzothiazol-3-ium-2-yl)-N,N-dimethylethenamine |
|---|---|
| PubChem CID | 54084639 |
| Molecular Formula | C15H21N2S+ |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 2-(3-butyl-1,3-benzothiazol-3-ium-2-yl)-N,N-dimethylethenamine |
| SMILES | CCCC[n+]1c(C=CN(C)C)sc2ccccc21 |
| InChI | InChI=1S/C15H21N2S/c1-4-5-11-17-13-8-6-7-9-14(13)18-15(17)10-12-16(2)3/h6-10,12H,4-5,11H2,1-3H3/q+1 |
| InChIKey | MPODFXLFVUPTGV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|