C22H28N3S+ — CID 173408359
4-[2-[3-[3-(dimethylamino)propyl]-1,3-benzothiazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 173408359) has the molecular formula C22H28N3S+ and a molecular weight of 366.55 g/mol. Its IUPAC name is 4-[2-[3-[3-(dimethylamino)propyl]-1,3-benzothiazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[3-[3-(dimethylamino)propyl]-1,3-benzothiazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 173408359 |
| Molecular Formula | C22H28N3S+ |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 4-[2-[3-[3-(dimethylamino)propyl]-1,3-benzothiazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)CCC[n+]1c(C=Cc2ccc(N(C)C)cc2)sc2ccccc21 |
| InChI | InChI=1S/C22H28N3S/c1-23(2)16-7-17-25-20-8-5-6-9-21(20)26-22(25)15-12-18-10-13-19(14-11-18)24(3)4/h5-6,8-15H,7,16-17H2,1-4H3/q+1 |
| InChIKey | ZJQDXSLXBSMCGZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|