C25H33N2S+ — CID 58900947
N,N-dimethyl-4-[(E)-2-(3-octyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]aniline (PubChem CID 58900947) has the molecular formula C25H33N2S+ and a molecular weight of 393.62 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-(3-octyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-2-(3-octyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 58900947 |
| Molecular Formula | C25H33N2S+ |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-(3-octyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]aniline |
| SMILES | CCCCCCCC[n+]1c(/C=C/c2ccc(N(C)C)cc2)sc2ccccc21 |
| InChI | InChI=1S/C25H33N2S/c1-4-5-6-7-8-11-20-27-23-12-9-10-13-24(23)28-25(27)19-16-21-14-17-22(18-15-21)26(2)3/h9-10,12-19H,4-8,11,20H2,1-3H3/q+1 |
| InChIKey | LRCUNKXZBBXHJE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|