C20H23N2O3S2+ — CID 15799742
3-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid (PubChem CID 15799742) has the molecular formula C20H23N2O3S2+ and a molecular weight of 403.55 g/mol. Its IUPAC name is 3-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 15799742 |
| Molecular Formula | C20H23N2O3S2+ |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 3-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid |
| SMILES | CN(C)c1ccc(/C=C/c2sc3ccccc3[n+]2CCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C20H22N2O3S2/c1-21(2)17-11-8-16(9-12-17)10-13-20-22(14-5-15-27(23,24)25)18-6-3-4-7-19(18)26-20/h3-4,6-13H,5,14-15H2,1-2H3/p+1 |
| InChIKey | MYBYPJSKCGTKAD-UHFFFAOYSA-O |
| XLogP | 3.70 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|