C25H25N2OS2+ — CID 177446051
2-[2-[(E)-2-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]ethanol (PubChem CID 177446051) has the molecular formula C25H25N2OS2+ and a molecular weight of 433.62 g/mol. Its IUPAC name is 2-[2-[(E)-2-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]ethanol.
| Compound Name | 2-[2-[(E)-2-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]ethanol |
|---|---|
| PubChem CID | 177446051 |
| Molecular Formula | C25H25N2OS2+ |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 2-[2-[(E)-2-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]ethanol |
| SMILES | CN(C)c1ccc(/C=C/c2ccc(/C=C/c3sc4ccccc4[n+]3CCO)s2)cc1 |
| InChI | InChI=1S/C25H25N2OS2/c1-26(2)20-10-7-19(8-11-20)9-12-21-13-14-22(29-21)15-16-25-27(17-18-28)23-5-3-4-6-24(23)30-25/h3-16,28H,17-18H2,1-2H3/q+1 |
| InChIKey | NPMLDRDKFHJVAS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 27.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|