C39H42Br2N4S2 — CID 24879409
4-[(E)-2-[3-[5-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]pentyl]-1,3-benzothiazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline dibromide (PubChem CID 24879409) has the molecular formula C39H42Br2N4S2 and a molecular weight of 790.74 g/mol. Its IUPAC name is 4-[(E)-2-[3-[5-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]pentyl]-1,3-benzothiazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline dibromide.
| Compound Name | 4-[(E)-2-[3-[5-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]pentyl]-1,3-benzothiazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline dibromide |
|---|---|
| PubChem CID | 24879409 |
| Molecular Formula | C39H42Br2N4S2 |
| Molecular Weight | 790.74 g/mol |
| Exact Mass | 788.12 |
| IUPAC Name | 4-[(E)-2-[3-[5-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]pentyl]-1,3-benzothiazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline dibromide |
| SMILES | CN(C)c1ccc(/C=C/c2sc3ccccc3[n+]2CCCCC[n+]2c(/C=C/c3ccc(N(C)C)cc3)sc3ccccc32)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C39H42N4S2.2BrH/c1-40(2)32-22-16-30(17-23-32)20-26-38-42(34-12-6-8-14-36(34)44-38)28-10-5-11-29-43-35-13-7-9-15-37(35)45-39(43)27-21-31-18-24-33(25-19-31)41(3)4;;/h6-9,12-27H,5,10-11,28-29H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | HMUXETJPBRYQRW-UHFFFAOYSA-L |
| XLogP | 3.04 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.74 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|