C20H21N2O2S+ — CID 74006978
3-[2-[2-[4-(dimethylamino)phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]propanoic acid (PubChem CID 74006978) has the molecular formula C20H21N2O2S+ and a molecular weight of 353.47 g/mol. Its IUPAC name is 3-[2-[2-[4-(dimethylamino)phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]propanoic acid.
| Compound Name | 3-[2-[2-[4-(dimethylamino)phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]propanoic acid |
|---|---|
| PubChem CID | 74006978 |
| Molecular Formula | C20H21N2O2S+ |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 3-[2-[2-[4-(dimethylamino)phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]propanoic acid |
| SMILES | CN(C)c1ccc(C=Cc2sc3ccccc3[n+]2CCC(=O)O)cc1 |
| InChI | InChI=1S/C20H20N2O2S/c1-21(2)16-10-7-15(8-11-16)9-12-19-22(14-13-20(23)24)17-5-3-4-6-18(17)25-19/h3-12H,13-14H2,1-2H3/p+1 |
| InChIKey | STJHOJMPJPYXNC-UHFFFAOYSA-O |
| XLogP | 3.90 |
| TPSA | 44.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|