C30H27BrN2S — CID 67570967
N,N-dimethyl-4-[(E)-2-[3-[(2-phenylphenyl)methyl]-1,3-benzothiazol-3-ium-2-yl]ethenyl]aniline bromide (PubChem CID 67570967) has the molecular formula C30H27BrN2S and a molecular weight of 527.53 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-[3-[(2-phenylphenyl)methyl]-1,3-benzothiazol-3-ium-2-yl]ethenyl]aniline bromide.
| Compound Name | N,N-dimethyl-4-[(E)-2-[3-[(2-phenylphenyl)methyl]-1,3-benzothiazol-3-ium-2-yl]ethenyl]aniline bromide |
|---|---|
| PubChem CID | 67570967 |
| Molecular Formula | C30H27BrN2S |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-[3-[(2-phenylphenyl)methyl]-1,3-benzothiazol-3-ium-2-yl]ethenyl]aniline bromide |
| SMILES | CN(C)c1ccc(/C=C/c2sc3ccccc3[n+]2Cc2ccccc2-c2ccccc2)cc1.[Br-] |
| InChI | InChI=1S/C30H27N2S.BrH/c1-31(2)26-19-16-23(17-20-26)18-21-30-32(28-14-8-9-15-29(28)33-30)22-25-12-6-7-13-27(25)24-10-4-3-5-11-24;/h3-21H,22H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | NNVXVSOUZNDEFT-UHFFFAOYSA-M |
| XLogP | 4.14 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|