C28H25N2S+ — CID 57395970
N,N-dimethyl-4-[(E)-2-[3-(naphthalen-2-ylmethyl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]aniline (PubChem CID 57395970) has the molecular formula C28H25N2S+ and a molecular weight of 421.59 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-[3-(naphthalen-2-ylmethyl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-2-[3-(naphthalen-2-ylmethyl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 57395970 |
| Molecular Formula | C28H25N2S+ |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-[3-(naphthalen-2-ylmethyl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/c2sc3ccccc3[n+]2Cc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C28H25N2S/c1-29(2)25-16-12-21(13-17-25)14-18-28-30(26-9-5-6-10-27(26)31-28)20-22-11-15-23-7-3-4-8-24(23)19-22/h3-19H,20H2,1-2H3/q+1 |
| InChIKey | LFXHYLDJPDWNPA-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|