C25H33IN2OS — CID 67571860
4-[(E)-2-(3-heptyl-6-methoxy-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide (PubChem CID 67571860) has the molecular formula C25H33IN2OS and a molecular weight of 536.52 g/mol. Its IUPAC name is 4-[(E)-2-(3-heptyl-6-methoxy-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide.
| Compound Name | 4-[(E)-2-(3-heptyl-6-methoxy-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide |
|---|---|
| PubChem CID | 67571860 |
| Molecular Formula | C25H33IN2OS |
| Molecular Weight | 536.52 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 4-[(E)-2-(3-heptyl-6-methoxy-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide |
| SMILES | CCCCCCC[n+]1c(/C=C/c2ccc(N(C)C)cc2)sc2cc(OC)ccc21.[I-] |
| InChI | InChI=1S/C25H33N2OS.HI/c1-5-6-7-8-9-18-27-23-16-15-22(28-4)19-24(23)29-25(27)17-12-20-10-13-21(14-11-20)26(2)3;/h10-17,19H,5-9,18H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | CTLKICKSZPFHMI-UHFFFAOYSA-M |
| XLogP | 3.41 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|