C21H31N2S+ — CID 10116101
4-[(E)-2-(3-heptyl-4-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline (PubChem CID 10116101) has the molecular formula C21H31N2S+ and a molecular weight of 343.56 g/mol. Its IUPAC name is 4-[(E)-2-(3-heptyl-4-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-(3-heptyl-4-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 10116101 |
| Molecular Formula | C21H31N2S+ |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | 4-[(E)-2-(3-heptyl-4-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline |
| SMILES | CCCCCCC[n+]1c(C)csc1/C=C/c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H31N2S/c1-5-6-7-8-9-16-23-18(2)17-24-21(23)15-12-19-10-13-20(14-11-19)22(3)4/h10-15,17H,5-9,16H2,1-4H3/q+1 |
| InChIKey | LVVFRFUOQWHWEA-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|