C15H19IN2S — CID 86217737
4-[2-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide (PubChem CID 86217737) has the molecular formula C15H19IN2S and a molecular weight of 386.30 g/mol. Its IUPAC name is 4-[2-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide.
| Compound Name | 4-[2-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide |
|---|---|
| PubChem CID | 86217737 |
| Molecular Formula | C15H19IN2S |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 4-[2-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide |
| SMILES | Cc1csc(C=Cc2ccc(N(C)C)cc2)[n+]1C.[I-] |
| InChI | InChI=1S/C15H19N2S.HI/c1-12-11-18-15(17(12)4)10-7-13-5-8-14(9-6-13)16(2)3;/h5-11H,1-4H3;1H/q+1;/p-1 |
| InChIKey | NIIHCNHCEHXBDS-UHFFFAOYSA-M |
| XLogP | 0.12 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|