C24H23IN2OS — CID 25136677
N,N-dimethyl-4-[(E)-2-[5-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]furan-2-yl]ethenyl]aniline iodide (PubChem CID 25136677) has the molecular formula C24H23IN2OS and a molecular weight of 514.43 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-[5-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]furan-2-yl]ethenyl]aniline iodide.
| Compound Name | N,N-dimethyl-4-[(E)-2-[5-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]furan-2-yl]ethenyl]aniline iodide |
|---|---|
| PubChem CID | 25136677 |
| Molecular Formula | C24H23IN2OS |
| Molecular Weight | 514.43 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-[5-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]furan-2-yl]ethenyl]aniline iodide |
| SMILES | CN(C)c1ccc(/C=C/c2ccc(/C=C/c3sc4ccccc4[n+]3C)o2)cc1.[I-] |
| InChI | InChI=1S/C24H23N2OS.HI/c1-25(2)19-11-8-18(9-12-19)10-13-20-14-15-21(27-20)16-17-24-26(3)22-6-4-5-7-23(22)28-24;/h4-17H,1-3H3;1H/q+1;/p-1 |
| InChIKey | PUYBXZBYZKCGJZ-UHFFFAOYSA-M |
| XLogP | 2.73 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|