C21H23IN2S — CID 11070597
N,N-dimethyl-4-[(1E,3E)-3-methyl-4-(3-methyl-1,3-benzothiazol-3-ium-2-yl)buta-1,3-dienyl]aniline iodide (PubChem CID 11070597) has the molecular formula C21H23IN2S and a molecular weight of 462.40 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1E,3E)-3-methyl-4-(3-methyl-1,3-benzothiazol-3-ium-2-yl)buta-1,3-dienyl]aniline iodide.
| Compound Name | N,N-dimethyl-4-[(1E,3E)-3-methyl-4-(3-methyl-1,3-benzothiazol-3-ium-2-yl)buta-1,3-dienyl]aniline iodide |
|---|---|
| PubChem CID | 11070597 |
| Molecular Formula | C21H23IN2S |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | N,N-dimethyl-4-[(1E,3E)-3-methyl-4-(3-methyl-1,3-benzothiazol-3-ium-2-yl)buta-1,3-dienyl]aniline iodide |
| SMILES | CC(/C=C/c1ccc(N(C)C)cc1)=C\c1sc2ccccc2[n+]1C.[I-] |
| InChI | InChI=1S/C21H23N2S.HI/c1-16(9-10-17-11-13-18(14-12-17)22(2)3)15-21-23(4)19-7-5-6-8-20(19)24-21;/h5-15H,1-4H3;1H/q+1;/p-1 |
| InChIKey | DSLIPPLANMSQHU-UHFFFAOYSA-M |
| XLogP | 1.91 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|