C16H13ClINS — CID 54604878
2-[(E)-2-(4-chlorophenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium iodide (PubChem CID 54604878) has the molecular formula C16H13ClINS and a molecular weight of 413.71 g/mol. Its IUPAC name is 2-[(E)-2-(4-chlorophenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium iodide.
| Compound Name | 2-[(E)-2-(4-chlorophenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium iodide |
|---|---|
| PubChem CID | 54604878 |
| Molecular Formula | C16H13ClINS |
| Molecular Weight | 413.71 g/mol |
| Exact Mass | 412.95 |
| IUPAC Name | 2-[(E)-2-(4-chlorophenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium iodide |
| SMILES | C[n+]1c(/C=C/c2ccc(Cl)cc2)sc2ccccc21.[I-] |
| InChI | InChI=1S/C16H13ClNS.HI/c1-18-14-4-2-3-5-15(14)19-16(18)11-8-12-6-9-13(17)10-7-12;/h2-11H,1H3;1H/q+1;/p-1/b11-8+; |
| InChIKey | QUDXHZHAWBZDDO-YGCVIUNWSA-M |
| XLogP | 1.55 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.71 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|