C16H15ClNO4S+ — CID 126957470
3-methyl-2-[(E)-2-phenylethenyl]-1,3-benzothiazol-3-ium;perchloric acid (PubChem CID 126957470) has the molecular formula C16H15ClNO4S+ and a molecular weight of 352.82 g/mol. Its IUPAC name is 3-methyl-2-[(E)-2-phenylethenyl]-1,3-benzothiazol-3-ium;perchloric acid.
| Compound Name | 3-methyl-2-[(E)-2-phenylethenyl]-1,3-benzothiazol-3-ium;perchloric acid |
|---|---|
| PubChem CID | 126957470 |
| Molecular Formula | C16H15ClNO4S+ |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 3-methyl-2-[(E)-2-phenylethenyl]-1,3-benzothiazol-3-ium;perchloric acid |
| SMILES | C[n+]1c(/C=C/c2ccccc2)sc2ccccc21.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C16H14NS.ClHO4/c1-17-14-9-5-6-10-15(14)18-16(17)12-11-13-7-3-2-4-8-13;2-1(3,4)5/h2-12H,1H3;(H,2,3,4,5)/q+1;/b12-11+; |
| InChIKey | OHIUADVCTIRCAV-CALJPSDSSA-N |
| XLogP | -0.23 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|