C20H16NS+ — CID 101000409
3-methyl-2-[(E)-2-naphthalen-2-ylethenyl]-1,3-benzothiazol-3-ium (PubChem CID 101000409) has the molecular formula C20H16NS+ and a molecular weight of 302.42 g/mol. Its IUPAC name is 3-methyl-2-[(E)-2-naphthalen-2-ylethenyl]-1,3-benzothiazol-3-ium.
| Compound Name | 3-methyl-2-[(E)-2-naphthalen-2-ylethenyl]-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 101000409 |
| Molecular Formula | C20H16NS+ |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 3-methyl-2-[(E)-2-naphthalen-2-ylethenyl]-1,3-benzothiazol-3-ium |
| SMILES | C[n+]1c(/C=C/c2ccc3ccccc3c2)sc2ccccc21 |
| InChI | InChI=1S/C20H16NS/c1-21-18-8-4-5-9-19(18)22-20(21)13-11-15-10-12-16-6-2-3-7-17(16)14-15/h2-14H,1H3/q+1/b13-11+ |
| InChIKey | PNZFNLBNRYQBDD-ACCUITESSA-N |
| XLogP | 5.05 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|