C14H12NS2+ — CID 5249028
3-methyl-2-(2-thiophen-2-ylethenyl)-1,3-benzothiazol-3-ium (PubChem CID 5249028) has the molecular formula C14H12NS2+ and a molecular weight of 258.39 g/mol. Its IUPAC name is 3-methyl-2-(2-thiophen-2-ylethenyl)-1,3-benzothiazol-3-ium.
| Compound Name | 3-methyl-2-(2-thiophen-2-ylethenyl)-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 5249028 |
| Molecular Formula | C14H12NS2+ |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 3-methyl-2-(2-thiophen-2-ylethenyl)-1,3-benzothiazol-3-ium |
| SMILES | C[n+]1c(C=Cc2cccs2)sc2ccccc21 |
| InChI | InChI=1S/C14H12NS2/c1-15-12-6-2-3-7-13(12)17-14(15)9-8-11-5-4-10-16-11/h2-10H,1H3/q+1 |
| InChIKey | UZNJOFRBSDJVIZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|