C18H18NOS+ — CID 10150699
2-[(E)-3-(2,6-dimethylpyran-4-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium (PubChem CID 10150699) has the molecular formula C18H18NOS+ and a molecular weight of 296.42 g/mol. Its IUPAC name is 2-[(E)-3-(2,6-dimethylpyran-4-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[(E)-3-(2,6-dimethylpyran-4-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 10150699 |
| Molecular Formula | C18H18NOS+ |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-[(E)-3-(2,6-dimethylpyran-4-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium |
| SMILES | CC1=CC(=C/C=C/c2sc3ccccc3[n+]2C)C=C(C)O1 |
| InChI | InChI=1S/C18H18NOS/c1-13-11-15(12-14(2)20-13)7-6-10-18-19(3)16-8-4-5-9-17(16)21-18/h4-12H,1-3H3/q+1/b10-6+ |
| InChIKey | DYCZWKOLMJCUIM-UXBLZVDNSA-N |
| XLogP | 4.50 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|