C19H16FN2S2+ — CID 90666967
(2Z)-5-fluoro-3-methyl-2-[(E)-3-(3-methyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-1,3-benzothiazole (PubChem CID 90666967) has the molecular formula C19H16FN2S2+ and a molecular weight of 355.48 g/mol. Its IUPAC name is (2Z)-5-fluoro-3-methyl-2-[(E)-3-(3-methyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-1,3-benzothiazole.
| Compound Name | (2Z)-5-fluoro-3-methyl-2-[(E)-3-(3-methyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-1,3-benzothiazole |
|---|---|
| PubChem CID | 90666967 |
| Molecular Formula | C19H16FN2S2+ |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | (2Z)-5-fluoro-3-methyl-2-[(E)-3-(3-methyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-1,3-benzothiazole |
| SMILES | CN1/C(=C/C=C/c2sc3ccccc3[n+]2C)Sc2ccc(F)cc21 |
| InChI | InChI=1S/C19H16FN2S2/c1-21-14-6-3-4-7-16(14)23-18(21)8-5-9-19-22(2)15-12-13(20)10-11-17(15)24-19/h3-12H,1-2H3/q+1 |
| InChIKey | FOTGCPUEJLQVRX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|