C26H27N2OS2+ — CID 159020566
(2Z)-2-[(2E,4E,6E)-7-(6-ethyl-3-methyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-6-methoxy-3-methyl-1,3-benzothiazole (PubChem CID 159020566) has the molecular formula C26H27N2OS2+ and a molecular weight of 447.65 g/mol. Its IUPAC name is (2Z)-2-[(2E,4E,6E)-7-(6-ethyl-3-methyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-6-methoxy-3-methyl-1,3-benzothiazole.
| Compound Name | (2Z)-2-[(2E,4E,6E)-7-(6-ethyl-3-methyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-6-methoxy-3-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 159020566 |
| Molecular Formula | C26H27N2OS2+ |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (2Z)-2-[(2E,4E,6E)-7-(6-ethyl-3-methyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-6-methoxy-3-methyl-1,3-benzothiazole |
| SMILES | CCc1ccc2c(c1)sc(/C=C/C=C/C=C/C=C1\Sc3cc(OC)ccc3N1C)[n+]2C |
| InChI | InChI=1S/C26H27N2OS2/c1-5-19-13-15-21-23(17-19)30-25(27(21)2)11-9-7-6-8-10-12-26-28(3)22-16-14-20(29-4)18-24(22)31-26/h6-18H,5H2,1-4H3/q+1 |
| InChIKey | JTQHLRAUSKDQDP-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|