C19H19N2S2+ — CID 58081994
(2Z)-2-[(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3,6-dimethyl-1,3-benzothiazole (PubChem CID 58081994) has the molecular formula C19H19N2S2+ and a molecular weight of 339.51 g/mol. Its IUPAC name is (2Z)-2-[(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3,6-dimethyl-1,3-benzothiazole.
| Compound Name | (2Z)-2-[(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3,6-dimethyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 58081994 |
| Molecular Formula | C19H19N2S2+ |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (2Z)-2-[(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3,6-dimethyl-1,3-benzothiazole |
| SMILES | Cc1ccc2c(c1)S/C(=C\c1sc3cc(C)ccc3[n+]1C)N2C |
| InChI | InChI=1S/C19H19N2S2/c1-12-5-7-14-16(9-12)22-18(20(14)3)11-19-21(4)15-8-6-13(2)10-17(15)23-19/h5-11H,1-4H3/q+1 |
| InChIKey | IEGYSOLDCGVBDU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|