C23H18ClN2S2+ — CID 134116067
(2Z)-2-[(6-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-methyl-6-phenyl-1,3-benzothiazole (PubChem CID 134116067) has the molecular formula C23H18ClN2S2+ and a molecular weight of 422.00 g/mol. Its IUPAC name is (2Z)-2-[(6-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-methyl-6-phenyl-1,3-benzothiazole.
| Compound Name | (2Z)-2-[(6-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-methyl-6-phenyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 134116067 |
| Molecular Formula | C23H18ClN2S2+ |
| Molecular Weight | 422.00 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | (2Z)-2-[(6-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-methyl-6-phenyl-1,3-benzothiazole |
| SMILES | CN1/C(=C/c2sc3cc(Cl)ccc3[n+]2C)Sc2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C23H18ClN2S2/c1-25-18-10-8-16(15-6-4-3-5-7-15)12-20(18)27-22(25)14-23-26(2)19-11-9-17(24)13-21(19)28-23/h3-14H,1-2H3/q+1 |
| InChIKey | VAIRFAJGXCRRQP-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.00 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|