C19H18ClN2OS2+ — CID 134101031
2-[(Z)-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)methyl]-6-ethoxy-3-methyl-1,3-benzothiazol-3-ium (PubChem CID 134101031) has the molecular formula C19H18ClN2OS2+ and a molecular weight of 389.95 g/mol. Its IUPAC name is 2-[(Z)-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)methyl]-6-ethoxy-3-methyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[(Z)-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)methyl]-6-ethoxy-3-methyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 134101031 |
| Molecular Formula | C19H18ClN2OS2+ |
| Molecular Weight | 389.95 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 2-[(Z)-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)methyl]-6-ethoxy-3-methyl-1,3-benzothiazol-3-ium |
| SMILES | CCOc1ccc2c(c1)sc(/C=C1\Sc3ccc(Cl)cc3N1C)[n+]2C |
| InChI | InChI=1S/C19H18ClN2OS2/c1-4-23-13-6-7-14-17(10-13)25-18(21(14)2)11-19-22(3)15-9-12(20)5-8-16(15)24-19/h5-11H,4H2,1-3H3/q+1 |
| InChIKey | LKNBYFNYXFHPSQ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.95 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|