C22H24Cl2N3O3S3+ — CID 54388440
ethylamino 4-[5-chloro-2-[(5-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonate (PubChem CID 54388440) has the molecular formula C22H24Cl2N3O3S3+ and a molecular weight of 545.56 g/mol. Its IUPAC name is ethylamino 4-[5-chloro-2-[(5-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonate.
| Compound Name | ethylamino 4-[5-chloro-2-[(5-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 54388440 |
| Molecular Formula | C22H24Cl2N3O3S3+ |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | ethylamino 4-[5-chloro-2-[(5-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonate |
| SMILES | CCNOS(=O)(=O)CCCCN1C(=Cc2sc3ccc(Cl)cc3[n+]2C)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C22H24Cl2N3O3S3/c1-3-25-30-33(28,29)11-5-4-10-27-18-13-16(24)7-9-20(18)32-22(27)14-21-26(2)17-12-15(23)6-8-19(17)31-21/h6-9,12-14,25H,3-5,10-11H2,1-2H3/q+1 |
| InChIKey | SYQSDUYCMARAIH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|