C21H22N2O5S3 — CID 59943301
3-[5-methoxy-2-[(5-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonate (PubChem CID 59943301) has the molecular formula C21H22N2O5S3 and a molecular weight of 478.62 g/mol. Its IUPAC name is 3-[5-methoxy-2-[(5-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonate.
| Compound Name | 3-[5-methoxy-2-[(5-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 59943301 |
| Molecular Formula | C21H22N2O5S3 |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 3-[5-methoxy-2-[(5-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonate |
| SMILES | COc1ccc2c(c1)N(CCCS(=O)(=O)[O-])C(=Cc1sc3ccc(OC)cc3[n+]1C)S2 |
| InChI | InChI=1S/C21H22N2O5S3/c1-22-16-11-14(27-2)5-7-18(16)29-20(22)13-21-23(9-4-10-31(24,25)26)17-12-15(28-3)6-8-19(17)30-21/h5-8,11-13H,4,9-10H2,1-3H3 |
| InChIKey | YSDLDWVYYIGSBQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|