C20H19N2OS2+ — CID 4205753
5-methoxy-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-prop-2-enyl-1,3-benzothiazole (PubChem CID 4205753) has the molecular formula C20H19N2OS2+ and a molecular weight of 367.52 g/mol. Its IUPAC name is 5-methoxy-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-prop-2-enyl-1,3-benzothiazole.
| Compound Name | 5-methoxy-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-prop-2-enyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 4205753 |
| Molecular Formula | C20H19N2OS2+ |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 5-methoxy-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-prop-2-enyl-1,3-benzothiazole |
| SMILES | C=CCN1C(=Cc2sc3ccccc3[n+]2C)Sc2ccc(OC)cc21 |
| InChI | InChI=1S/C20H19N2OS2/c1-4-11-22-16-12-14(23-3)9-10-18(16)25-20(22)13-19-21(2)15-7-5-6-8-17(15)24-19/h4-10,12-13H,1,11H2,2-3H3/q+1 |
| InChIKey | JIIDNQMQMUMMHC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|