C21H21IN2S2 — CID 146051259
3,6-dimethyl-2-[(Z)-(5-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium iodide (PubChem CID 146051259) has the molecular formula C21H21IN2S2 and a molecular weight of 492.45 g/mol. Its IUPAC name is 3,6-dimethyl-2-[(Z)-(5-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium iodide.
| Compound Name | 3,6-dimethyl-2-[(Z)-(5-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium iodide |
|---|---|
| PubChem CID | 146051259 |
| Molecular Formula | C21H21IN2S2 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | 3,6-dimethyl-2-[(Z)-(5-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium iodide |
| SMILES | C=CCN1/C(=C/c2sc3cc(C)ccc3[n+]2C)Sc2ccc(C)cc21.[I-] |
| InChI | InChI=1S/C21H21N2S2.HI/c1-5-10-23-17-11-14(2)7-9-18(17)24-21(23)13-20-22(4)16-8-6-15(3)12-19(16)25-20;/h5-9,11-13H,1,10H2,2-4H3;1H/q+1;/p-1 |
| InChIKey | SUCDETAFVDICGF-UHFFFAOYSA-M |
| XLogP | 2.44 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|