C23H20N3OS3+ — CID 85327821
2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 85327821) has the molecular formula C23H20N3OS3+ and a molecular weight of 450.63 g/mol. Its IUPAC name is 2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | 2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 85327821 |
| Molecular Formula | C23H20N3OS3+ |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCn1c(=Cc2sc3ccccc3[n+]2C)sc(=C2Sc3ccccc3N2C)c1=O |
| InChI | InChI=1S/C23H20N3OS3/c1-4-13-26-20(14-19-24(2)15-9-5-7-11-17(15)28-19)30-21(22(26)27)23-25(3)16-10-6-8-12-18(16)29-23/h4-12,14H,1,13H2,2-3H3/q+1 |
| InChIKey | MZJCOKZBOUUIHL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|