C32H31N3O5S4 — CID 135593957
4-methylbenzenesulfonate;(2Z,5Z)-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 135593957) has the molecular formula C32H31N3O5S4 and a molecular weight of 665.88 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;(2Z,5Z)-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | 4-methylbenzenesulfonate;(2Z,5Z)-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135593957 |
| Molecular Formula | C32H31N3O5S4 |
| Molecular Weight | 665.88 g/mol |
| Exact Mass | 665.11 |
| IUPAC Name | 4-methylbenzenesulfonate;(2Z,5Z)-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | CN1/C(=c2/s/c(=C\c3sc4ccccc4[n+]3C)n(CC3CCCO3)c2=O)Sc2ccccc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C25H24N3O2S3.C7H8O3S/c1-26-17-9-3-5-11-19(17)31-21(26)14-22-28(15-16-8-7-13-30-16)24(29)23(33-22)25-27(2)18-10-4-6-12-20(18)32-25;1-6-2-4-7(5-3-6)11(8,9)10/h3-6,9-12,14,16H,7-8,13,15H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1/b25-23-; |
| InChIKey | QSPXLLDYHCZECS-ADYMNVQMSA-M |
| XLogP | 4.16 |
| TPSA | 95.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.88 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|