C21H20N3OS2+ — CID 162657450
(2E,5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methylpyridin-1-ium-4-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 162657450) has the molecular formula C21H20N3OS2+ and a molecular weight of 394.55 g/mol. Its IUPAC name is (2E,5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methylpyridin-1-ium-4-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methylpyridin-1-ium-4-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 162657450 |
| Molecular Formula | C21H20N3OS2+ |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (2E,5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methylpyridin-1-ium-4-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCn1c(=O)/c(=C2\Sc3ccccc3N2C)s/c1=C/c1cc[n+](C)cc1 |
| InChI | InChI=1S/C21H20N3OS2/c1-4-11-24-18(14-15-9-12-22(2)13-10-15)27-19(20(24)25)21-23(3)16-7-5-6-8-17(16)26-21/h4-10,12-14H,1,11H2,2-3H3/q+1/b21-19+ |
| InChIKey | VYSGVTNXZSJXLP-XUTLUUPISA-N |
| XLogP | 2.06 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|