C24H26ClN3O3S2 — CID 162659327
5-[4-[(E)-[(5E)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]methyl]pyridin-1-ium-1-yl]pentanoic acid chloride (PubChem CID 162659327) has the molecular formula C24H26ClN3O3S2 and a molecular weight of 504.08 g/mol. Its IUPAC name is 5-[4-[(E)-[(5E)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]methyl]pyridin-1-ium-1-yl]pentanoic acid chloride.
| Compound Name | 5-[4-[(E)-[(5E)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]methyl]pyridin-1-ium-1-yl]pentanoic acid chloride |
|---|---|
| PubChem CID | 162659327 |
| Molecular Formula | C24H26ClN3O3S2 |
| Molecular Weight | 504.08 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | 5-[4-[(E)-[(5E)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]methyl]pyridin-1-ium-1-yl]pentanoic acid chloride |
| SMILES | CCn1c(=O)/c(=C2\Sc3ccccc3N2C)s/c1=C/c1cc[n+](CCCCC(=O)O)cc1.[Cl-] |
| InChI | InChI=1S/C24H25N3O3S2.ClH/c1-3-27-20(16-17-11-14-26(15-12-17)13-7-6-10-21(28)29)32-22(23(27)30)24-25(2)18-8-4-5-9-19(18)31-24;/h4-5,8-9,11-12,14-16H,3,6-7,10,13H2,1-2H3;1H/b24-22+; |
| InChIKey | SDJUUUUZYJAGMQ-HDPAMLMOSA-N |
| XLogP | -0.39 |
| TPSA | 66.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.08 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|