C26H24N3OS2+ — CID 162649109
(2E,5E)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methyl-2-phenylpyridin-1-ium-4-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 162649109) has the molecular formula C26H24N3OS2+ and a molecular weight of 458.63 g/mol. Its IUPAC name is (2E,5E)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methyl-2-phenylpyridin-1-ium-4-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methyl-2-phenylpyridin-1-ium-4-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 162649109 |
| Molecular Formula | C26H24N3OS2+ |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | (2E,5E)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methyl-2-phenylpyridin-1-ium-4-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCn1c(=O)/c(=C2\Sc3ccccc3N2C)s/c1=C/c1cc[n+](C)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C26H24N3OS2/c1-4-29-23(17-18-14-15-27(2)21(16-18)19-10-6-5-7-11-19)32-24(25(29)30)26-28(3)20-12-8-9-13-22(20)31-26/h5-17H,4H2,1-3H3/q+1/b26-24+ |
| InChIKey | ZIIZSWATDWQWTC-SHHOIMCASA-N |
| XLogP | 3.56 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|