C22H22ClN3OS2 — CID 85326239
2-[(1-ethylpyridin-1-ium-2-yl)methylidene]-5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one chloride (PubChem CID 85326239) has the molecular formula C22H22ClN3OS2 and a molecular weight of 444.03 g/mol. Its IUPAC name is 2-[(1-ethylpyridin-1-ium-2-yl)methylidene]-5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one chloride.
| Compound Name | 2-[(1-ethylpyridin-1-ium-2-yl)methylidene]-5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one chloride |
|---|---|
| PubChem CID | 85326239 |
| Molecular Formula | C22H22ClN3OS2 |
| Molecular Weight | 444.03 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 2-[(1-ethylpyridin-1-ium-2-yl)methylidene]-5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one chloride |
| SMILES | C=CCn1c(=Cc2cccc[n+]2CC)sc(=C2Sc3ccccc3N2C)c1=O.[Cl-] |
| InChI | InChI=1S/C22H22N3OS2.ClH/c1-4-13-25-19(15-16-10-8-9-14-24(16)5-2)28-20(21(25)26)22-23(3)17-11-6-7-12-18(17)27-22;/h4,6-12,14-15H,1,5,13H2,2-3H3;1H/q+1;/p-1 |
| InChIKey | DZXRYXJGXSYZNG-UHFFFAOYSA-M |
| XLogP | -0.46 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.03 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|