C27H25IN3OS2+ — CID 72784200
3-ethyl-2-[(1-ethylpyridin-1-ium-2-yl)methylidene]-5-[3-[(4-iodophenyl)methyl]-1,3-benzothiazol-2-ylidene]-1,3-thiazolidin-4-one (PubChem CID 72784200) has the molecular formula C27H25IN3OS2+ and a molecular weight of 598.56 g/mol. Its IUPAC name is 3-ethyl-2-[(1-ethylpyridin-1-ium-2-yl)methylidene]-5-[3-[(4-iodophenyl)methyl]-1,3-benzothiazol-2-ylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-ethyl-2-[(1-ethylpyridin-1-ium-2-yl)methylidene]-5-[3-[(4-iodophenyl)methyl]-1,3-benzothiazol-2-ylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 72784200 |
| Molecular Formula | C27H25IN3OS2+ |
| Molecular Weight | 598.56 g/mol |
| Exact Mass | 598.05 |
| IUPAC Name | 3-ethyl-2-[(1-ethylpyridin-1-ium-2-yl)methylidene]-5-[3-[(4-iodophenyl)methyl]-1,3-benzothiazol-2-ylidene]-1,3-thiazolidin-4-one |
| SMILES | CCn1c(=Cc2cccc[n+]2CC)sc(=C2Sc3ccccc3N2Cc2ccc(I)cc2)c1=O |
| InChI | InChI=1S/C27H25IN3OS2/c1-3-29-16-8-7-9-21(29)17-24-30(4-2)26(32)25(34-24)27-31(18-19-12-14-20(28)15-13-19)22-10-5-6-11-23(22)33-27/h5-17H,3-4,18H2,1-2H3/q+1 |
| InChIKey | LFSVRRUJWATNNX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|