About (2Z)-3-ethyl-2-[(1-prop-2-enylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide
(2Z)-3-ethyl-2-[(1-prop-2-enylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide (PubChem CID 45489353) has the molecular formula C18H19IN2S
and a molecular weight of 422.34 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-[(1-prop-2-enylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide.
Molecular Properties
| Compound Name | (2Z)-3-ethyl-2-[(1-prop-2-enylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide |
| PubChem CID | 45489353 |
| Molecular Formula | C18H19IN2S |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | (2Z)-3-ethyl-2-[(1-prop-2-enylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide |
| SMILES | C=CC[n+]1ccccc1/C=C1\Sc2ccccc2N1CC.[I-] |
| InChI | InChI=1S/C18H19N2S.HI/c1-3-12-19-13-8-7-9-15(19)14-18-20(4-2)16-10-5-6-11-17(16)21-18;/h3,5-11,13-14H,1,4,12H2,2H3;1H/q+1;/p-1 |
| InChIKey | MMYKIFKSZIHMCG-UHFFFAOYSA-M |
| XLogP | 1.09 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-3-ethyl-2-[(1-prop-2-enylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3-ethyl-2-[(1-prop-2-enylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide?
The IUPAC name of (2Z)-3-ethyl-2-[(1-prop-2-enylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide (CID 45489353) is (2Z)-3-ethyl-2-[(1-prop-2-enylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide.
What is the SMILES notation for (2Z)-3-ethyl-2-[(1-prop-2-enylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide?
The canonical SMILES for (2Z)-3-ethyl-2-[(1-prop-2-enylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide is C=CC[n+]1ccccc1/C=C1\Sc2ccccc2N1CC.[I-].
What is the InChIKey of (2Z)-3-ethyl-2-[(1-prop-2-enylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide?
The InChIKey is MMYKIFKSZIHMCG-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H19N2S.HI/c1-3-12-19-13-8-7-9-15(19)14-18-20(4-2)16-10-5-6-11-17(16)21-18;/h3,5-11,13-14H,1,4,12H2,2H3;1H/q+1;/p-1.
What are the key properties of (2Z)-3-ethyl-2-[(1-prop-2-enylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide?
(2Z)-3-ethyl-2-[(1-prop-2-enylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide has a molecular weight of 422.34 g/mol, XLogP of 1.09, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3-ethyl-2-[(1-prop-2-enylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide is sourced from PubChem (CID 45489353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).