C16H17IN2OS — CID 24747118
2-[2-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]ethanol iodide (PubChem CID 24747118) has the molecular formula C16H17IN2OS and a molecular weight of 412.30 g/mol. Its IUPAC name is 2-[2-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]ethanol iodide.
| Compound Name | 2-[2-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]ethanol iodide |
|---|---|
| PubChem CID | 24747118 |
| Molecular Formula | C16H17IN2OS |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | 2-[2-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]ethanol iodide |
| SMILES | CN1/C(=C/c2cccc[n+]2CCO)Sc2ccccc21.[I-] |
| InChI | InChI=1S/C16H17N2OS.HI/c1-17-14-7-2-3-8-15(14)20-16(17)12-13-6-4-5-9-18(13)10-11-19;/h2-9,12,19H,10-11H2,1H3;1H/q+1;/p-1 |
| InChIKey | UKQREQQAILHJBS-UHFFFAOYSA-M |
| XLogP | -0.49 |
| TPSA | 27.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|